Syntheses of 1-Alkyl-1,2,4-triazoles and the Formation of Quaternary 1-Alkyl-4-polyfluoroalkyl-1,2,4-triazolium Salts Leading to Ionic Liquids

1,2,4-triazole was alkylated (alkyl = methyl, butyl, heptyl, decyl) at N-1 in >90% isolated yields. The resulting 1-alkyl triazoles were quaternized at N-4 in >98% isolated yields using fluorinated alkyl halides with >98% isolated yields, under neat reaction conditions at 100-120 degrees C to form N1-CH(3)-N4-(CH(2))(2)C(m)F(2)(m)(+ 1)-triazolium (Taz) iodide (m = 1, 6), N1-C(4)H(9)-N4-(CH(2))(2)C(m)F(2)(m)(+ 1)-Taz iodide (m = 1, 4, 6), N1-C(7)H(15)-N4-(CH(2))(2)C(m)F(2)(m)(+ 1)-Taz iodide (m = 1, 4, 6), N1-C(10)H(21)-N4-(CH(2))(2)C(m)F(2)(m)(+1)-Taz iodide (m = 1, 4), and N1-C(n)H(2)(n )(+ 1)-N4-(CH(2))(2)F-Taz bromide (n = 4, 7, 10). Single-crystal X-ray analyses confirmed the structure of [1-CH(3)-4-CH(2)CH(2)CF(3)-Taz](+)I(-). It crystallized in the orthorhombic space group Pccn, and the unit cell dimensions were a = 13.8289(9) A, b = 17.3603(11) A, c = 9.0587(6) A (alpha = beta = gamma = 90 degrees ). Metathesis of these polyfluoroalkyl-substituted triazolium halides with other salts led to the formation of quaternary compounds, some of which comprise ionic liquids, namely, [R(R(f))-Taz](+)Y(-) (Y = NTf(2), BF(4), PF(6), and OTf), in good isolated yields without the need for further purification: N1-CH(3)-N4-(CH(2))(2)C(m)F(2)(m)( +) (1)-Taz Y (m = 1, 6; Y = NTf(2)), N1-C(4)H(9)-N4-(CH(2))(2)C(m)F(2)(m)(+ 1)-Taz Y (m = 1, 4, 6; Y = NTf(2)), N1- C(7)H(15)-N4-(CH(2))(2)C(m)F(2)(m)(+ 1)-Taz Y (m = 1, 4, 6; Y = NTf(2)), N1-C(10)H(21)-N4-(CH(2))(2)C(m)F(2)(m)(+1)-Taz Y (n = 1, 4; Y = NTf(2)), N1-C(n)H(2)(n )(+ 1)-N4-(CH(2))(2)F-Taz Y (n = 7, 10; Y = NTf(2)), N1-C(10)H(21)-N4-(CH(2))(2)F-TazY (Y = OTf), N1-C(7)H(15)-N4-(CH(2))(2)F-TazY (Y = BF(4)), N1-C(4)H(9)-N4-(CH(2))(2)C(m)F(2)(m) (+ 1)-Taz Y (m = 4, 6; Y = PF(6)), N1-C(7)H(15)-N4-(CH(2))(2)C(4)F(9)-Taz Y (Y = PF(6)), N1-C(4)H(9)-N4-(CH(2))(2)C(m)F(2)(m)(+ 1)-Taz Y (m = 4, 6; Y = OTf). All new compounds were characterized by (1)H, (19)F, and (13)C NMR and MS spectra and elemental analyses. T(g)s and T(m)s of ionic liquids were determined by DSC.