Novel Electrochemical Determination of Glucose Using a Carbon Quantum Dots (CQDs)/Co 2 (OH) 3 Cl/NiCl(OH) Nanocomposite

Zeolitic imidazolate framework-67 (ZIF-67) was firstly synthesized using cobalt (II) chloride hexahydrate and 2-methylimidazole. Then, glucose molecules were adsorbed into the ZIF-67 microporous structure and ZIF-67 loaded with carbon quantum dots (CQDs-ZIF-67) were synthesized by low-temperature calcination. CQDs-ZIF-67 and nickel chloride hexahydrate (II) were dissolved in anhydrous ethanol and CQDs/Co2(OH)3Cl/NiCl(OH) nanocomposites were synthesized by a hydrothermal method. A nonenzymatic glucose electrochemical sensor based on a glassy carbon electrode (GCE) modified by CQDs/Co2(OH)3Cl/NiCl(OH) was constructed and exhibited a wider linear range and a lower detection limit for glucose detection due to the abundant pore structure and good electrocatalytic activity of CQDs/Co2(OH)3Cl/NiCl(OH).